C30H27N3O6S — CID 19310888
N-[(Z)-3-[3-[2-(2,5-dimethoxyanilino)-2-oxoethyl]sulfanylanilino]-1-(furan-2-yl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19310888) has the molecular formula C30H27N3O6S and a molecular weight of 557.63 g/mol. Its IUPAC name is N-[(Z)-3-[3-[2-(2,5-dimethoxyanilino)-2-oxoethyl]sulfanylanilino]-1-(furan-2-yl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[3-[2-(2,5-dimethoxyanilino)-2-oxoethyl]sulfanylanilino]-1-(furan-2-yl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19310888 |
| Molecular Formula | C30H27N3O6S |
| Molecular Weight | 557.63 g/mol |
| Exact Mass | 557.16 |
| IUPAC Name | N-[(Z)-3-[3-[2-(2,5-dimethoxyanilino)-2-oxoethyl]sulfanylanilino]-1-(furan-2-yl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1ccc(OC)c(NC(=O)CSc2cccc(NC(=O)/C(=C/c3ccco3)NC(=O)c3ccccc3)c2)c1 |
| InChI | InChI=1S/C30H27N3O6S/c1-37-22-13-14-27(38-2)25(17-22)32-28(34)19-40-24-12-6-10-21(16-24)31-30(36)26(18-23-11-7-15-39-23)33-29(35)20-8-4-3-5-9-20/h3-18H,19H2,1-2H3,(H,31,36)(H,32,34)(H,33,35)/b26-18- |
| InChIKey | UTLCQJLUGBQUPU-ITYLOYPMSA-N |
| XLogP | 5.44 |
| TPSA | 118.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.63 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|