C34H33N3O7S — CID 19307431
N-[(E)-3-[3-[2-(2,4-dimethoxyanilino)-2-oxoethyl]sulfanylanilino]-1-(2,3-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19307431) has the molecular formula C34H33N3O7S and a molecular weight of 627.72 g/mol. Its IUPAC name is N-[(E)-3-[3-[2-(2,4-dimethoxyanilino)-2-oxoethyl]sulfanylanilino]-1-(2,3-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[2-(2,4-dimethoxyanilino)-2-oxoethyl]sulfanylanilino]-1-(2,3-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19307431 |
| Molecular Formula | C34H33N3O7S |
| Molecular Weight | 627.72 g/mol |
| Exact Mass | 627.20 |
| IUPAC Name | N-[(E)-3-[3-[2-(2,4-dimethoxyanilino)-2-oxoethyl]sulfanylanilino]-1-(2,3-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1ccc(NC(=O)CSc2cccc(NC(=O)/C(=C\c3cccc(OC)c3OC)NC(=O)c3ccccc3)c2)c(OC)c1 |
| InChI | InChI=1S/C34H33N3O7S/c1-41-25-16-17-27(30(20-25)43-3)36-31(38)21-45-26-14-9-13-24(19-26)35-34(40)28(37-33(39)22-10-6-5-7-11-22)18-23-12-8-15-29(42-2)32(23)44-4/h5-20H,21H2,1-4H3,(H,35,40)(H,36,38)(H,37,39)/b28-18+ |
| InChIKey | LCIGTSBVHKIKDA-MTDXEUNCSA-N |
| XLogP | 5.86 |
| TPSA | 124.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.72 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|