C33H31N3O6S — CID 19308872
N-[(E)-3-[3-[2-(2,5-dimethoxyanilino)-2-oxoethyl]sulfanylanilino]-1-(4-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19308872) has the molecular formula C33H31N3O6S and a molecular weight of 597.69 g/mol. Its IUPAC name is N-[(E)-3-[3-[2-(2,5-dimethoxyanilino)-2-oxoethyl]sulfanylanilino]-1-(4-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[2-(2,5-dimethoxyanilino)-2-oxoethyl]sulfanylanilino]-1-(4-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19308872 |
| Molecular Formula | C33H31N3O6S |
| Molecular Weight | 597.69 g/mol |
| Exact Mass | 597.19 |
| IUPAC Name | N-[(E)-3-[3-[2-(2,5-dimethoxyanilino)-2-oxoethyl]sulfanylanilino]-1-(4-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1ccc(/C=C(/NC(=O)c2ccccc2)C(=O)Nc2cccc(SCC(=O)Nc3cc(OC)ccc3OC)c2)cc1 |
| InChI | InChI=1S/C33H31N3O6S/c1-40-25-14-12-22(13-15-25)18-29(36-32(38)23-8-5-4-6-9-23)33(39)34-24-10-7-11-27(19-24)43-21-31(37)35-28-20-26(41-2)16-17-30(28)42-3/h4-20H,21H2,1-3H3,(H,34,39)(H,35,37)(H,36,38)/b29-18+ |
| InChIKey | LWWAAGIFPJSDRX-RDRPBHBLSA-N |
| XLogP | 5.85 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.69 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|