C36H30ClN3O5S — CID 19311460
N-[(E)-3-[3-[2-(5-chloro-2,4-dimethoxyanilino)-2-oxoethyl]sulfanylanilino]-1-naphthalen-1-yl-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19311460) has the molecular formula C36H30ClN3O5S and a molecular weight of 652.17 g/mol. Its IUPAC name is N-[(E)-3-[3-[2-(5-chloro-2,4-dimethoxyanilino)-2-oxoethyl]sulfanylanilino]-1-naphthalen-1-yl-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[2-(5-chloro-2,4-dimethoxyanilino)-2-oxoethyl]sulfanylanilino]-1-naphthalen-1-yl-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19311460 |
| Molecular Formula | C36H30ClN3O5S |
| Molecular Weight | 652.17 g/mol |
| Exact Mass | 651.16 |
| IUPAC Name | N-[(E)-3-[3-[2-(5-chloro-2,4-dimethoxyanilino)-2-oxoethyl]sulfanylanilino]-1-naphthalen-1-yl-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1cc(OC)c(NC(=O)CSc2cccc(NC(=O)/C(=C\c3cccc4ccccc34)NC(=O)c3ccccc3)c2)cc1Cl |
| InChI | InChI=1S/C36H30ClN3O5S/c1-44-32-21-33(45-2)30(20-29(32)37)39-34(41)22-46-27-16-9-15-26(19-27)38-36(43)31(40-35(42)24-11-4-3-5-12-24)18-25-14-8-13-23-10-6-7-17-28(23)25/h3-21H,22H2,1-2H3,(H,38,43)(H,39,41)(H,40,42)/b31-18+ |
| InChIKey | OFQRWQSYGGSJPJ-FDAWAROLSA-N |
| XLogP | 7.65 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.17 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|