C31H24Cl3N3O4S — CID 19306590
N-[(E)-3-[3-[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]sulfanylanilino]-1-(2,3-dichlorophenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19306590) has the molecular formula C31H24Cl3N3O4S and a molecular weight of 640.98 g/mol. Its IUPAC name is N-[(E)-3-[3-[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]sulfanylanilino]-1-(2,3-dichlorophenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]sulfanylanilino]-1-(2,3-dichlorophenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19306590 |
| Molecular Formula | C31H24Cl3N3O4S |
| Molecular Weight | 640.98 g/mol |
| Exact Mass | 639.06 |
| IUPAC Name | N-[(E)-3-[3-[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]sulfanylanilino]-1-(2,3-dichlorophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)CSc1cccc(NC(=O)/C(=C\c2cccc(Cl)c2Cl)NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C31H24Cl3N3O4S/c1-41-27-14-13-21(32)16-25(27)36-28(38)18-42-23-11-6-10-22(17-23)35-31(40)26(15-20-9-5-12-24(33)29(20)34)37-30(39)19-7-3-2-4-8-19/h2-17H,18H2,1H3,(H,35,40)(H,36,38)(H,37,39)/b26-15+ |
| InChIKey | GAPOQFIQIAVMCT-CVKSISIWSA-N |
| XLogP | 7.80 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.98 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|