C28H22BrN3O4S — CID 19310855
N-[(Z)-3-[3-[2-(4-bromoanilino)-2-oxoethyl]sulfanylanilino]-1-(furan-2-yl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19310855) has the molecular formula C28H22BrN3O4S and a molecular weight of 576.47 g/mol. Its IUPAC name is N-[(Z)-3-[3-[2-(4-bromoanilino)-2-oxoethyl]sulfanylanilino]-1-(furan-2-yl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[3-[2-(4-bromoanilino)-2-oxoethyl]sulfanylanilino]-1-(furan-2-yl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19310855 |
| Molecular Formula | C28H22BrN3O4S |
| Molecular Weight | 576.47 g/mol |
| Exact Mass | 575.05 |
| IUPAC Name | N-[(Z)-3-[3-[2-(4-bromoanilino)-2-oxoethyl]sulfanylanilino]-1-(furan-2-yl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(CSc1cccc(NC(=O)/C(=C/c2ccco2)NC(=O)c2ccccc2)c1)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C28H22BrN3O4S/c29-20-11-13-21(14-12-20)30-26(33)18-37-24-10-4-8-22(16-24)31-28(35)25(17-23-9-5-15-36-23)32-27(34)19-6-2-1-3-7-19/h1-17H,18H2,(H,30,33)(H,31,35)(H,32,34)/b25-17- |
| InChIKey | MIUKCIBSGUQFOR-UQQQWYQISA-N |
| XLogP | 6.18 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.47 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|