C28H19F4N3O4S — CID 19310913
N-[(Z)-1-(furan-2-yl)-3-oxo-3-[3-[2-oxo-2-(2,3,5,6-tetrafluoroanilino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 19310913) has the molecular formula C28H19F4N3O4S and a molecular weight of 569.54 g/mol. Its IUPAC name is N-[(Z)-1-(furan-2-yl)-3-oxo-3-[3-[2-oxo-2-(2,3,5,6-tetrafluoroanilino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(furan-2-yl)-3-oxo-3-[3-[2-oxo-2-(2,3,5,6-tetrafluoroanilino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19310913 |
| Molecular Formula | C28H19F4N3O4S |
| Molecular Weight | 569.54 g/mol |
| Exact Mass | 569.10 |
| IUPAC Name | N-[(Z)-1-(furan-2-yl)-3-oxo-3-[3-[2-oxo-2-(2,3,5,6-tetrafluoroanilino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | O=C(CSc1cccc(NC(=O)/C(=C/c2ccco2)NC(=O)c2ccccc2)c1)Nc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C28H19F4N3O4S/c29-20-14-21(30)25(32)26(24(20)31)35-23(36)15-40-19-10-4-8-17(12-19)33-28(38)22(13-18-9-5-11-39-18)34-27(37)16-6-2-1-3-7-16/h1-14H,15H2,(H,33,38)(H,34,37)(H,35,36)/b22-13- |
| InChIKey | NZJOPMYDCUIBAL-XKZIYDEJSA-N |
| XLogP | 5.98 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.54 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|