C31H24BrN3O6S — CID 19315238
5-[[2-[3-[[(Z)-2-benzamido-3-(4-bromophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-2-hydroxybenzoic acid (PubChem CID 19315238) has the molecular formula C31H24BrN3O6S and a molecular weight of 646.52 g/mol. Its IUPAC name is 5-[[2-[3-[[(Z)-2-benzamido-3-(4-bromophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-2-hydroxybenzoic acid.
| Compound Name | 5-[[2-[3-[[(Z)-2-benzamido-3-(4-bromophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 19315238 |
| Molecular Formula | C31H24BrN3O6S |
| Molecular Weight | 646.52 g/mol |
| Exact Mass | 645.06 |
| IUPAC Name | 5-[[2-[3-[[(Z)-2-benzamido-3-(4-bromophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-2-hydroxybenzoic acid |
| SMILES | O=C(CSc1cccc(NC(=O)/C(=C/c2ccc(Br)cc2)NC(=O)c2ccccc2)c1)Nc1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C31H24BrN3O6S/c32-21-11-9-19(10-12-21)15-26(35-29(38)20-5-2-1-3-6-20)30(39)34-22-7-4-8-24(16-22)42-18-28(37)33-23-13-14-27(36)25(17-23)31(40)41/h1-17,36H,18H2,(H,33,37)(H,34,39)(H,35,38)(H,40,41)/b26-15- |
| InChIKey | QHKYPGSWDVPPPG-YSMPRRRNSA-N |
| XLogP | 5.99 |
| TPSA | 144.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.52 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|