C31H24N4O8S — CID 22188641
5-[[2-[4-[[(Z)-2-benzamido-3-(4-nitrophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-2-hydroxybenzoic acid (PubChem CID 22188641) has the molecular formula C31H24N4O8S and a molecular weight of 612.62 g/mol. Its IUPAC name is 5-[[2-[4-[[(Z)-2-benzamido-3-(4-nitrophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-2-hydroxybenzoic acid.
| Compound Name | 5-[[2-[4-[[(Z)-2-benzamido-3-(4-nitrophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 22188641 |
| Molecular Formula | C31H24N4O8S |
| Molecular Weight | 612.62 g/mol |
| Exact Mass | 612.13 |
| IUPAC Name | 5-[[2-[4-[[(Z)-2-benzamido-3-(4-nitrophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-2-hydroxybenzoic acid |
| SMILES | O=C(CSc1ccc(NC(=O)/C(=C/c2ccc([N+](=O)[O-])cc2)NC(=O)c2ccccc2)cc1)Nc1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C31H24N4O8S/c36-27-15-10-22(17-25(27)31(40)41)32-28(37)18-44-24-13-8-21(9-14-24)33-30(39)26(34-29(38)20-4-2-1-3-5-20)16-19-6-11-23(12-7-19)35(42)43/h1-17,36H,18H2,(H,32,37)(H,33,39)(H,34,38)(H,40,41)/b26-16- |
| InChIKey | QORXCWJDRMJHNN-QQXSKIMKSA-N |
| XLogP | 5.14 |
| TPSA | 187.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.62 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|