C31H26N4O6S — CID 22188615
N-[(Z)-3-[4-[2-(3-methoxyanilino)-2-oxoethyl]sulfanylanilino]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 22188615) has the molecular formula C31H26N4O6S and a molecular weight of 582.64 g/mol. Its IUPAC name is N-[(Z)-3-[4-[2-(3-methoxyanilino)-2-oxoethyl]sulfanylanilino]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[2-(3-methoxyanilino)-2-oxoethyl]sulfanylanilino]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22188615 |
| Molecular Formula | C31H26N4O6S |
| Molecular Weight | 582.64 g/mol |
| Exact Mass | 582.16 |
| IUPAC Name | N-[(Z)-3-[4-[2-(3-methoxyanilino)-2-oxoethyl]sulfanylanilino]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1cccc(NC(=O)CSc2ccc(NC(=O)/C(=C/c3ccc([N+](=O)[O-])cc3)NC(=O)c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C31H26N4O6S/c1-41-26-9-5-8-24(19-26)32-29(36)20-42-27-16-12-23(13-17-27)33-31(38)28(34-30(37)22-6-3-2-4-7-22)18-21-10-14-25(15-11-21)35(39)40/h2-19H,20H2,1H3,(H,32,36)(H,33,38)(H,34,37)/b28-18- |
| InChIKey | KVSMHFMZXMMQQO-VEILYXNESA-N |
| XLogP | 5.74 |
| TPSA | 139.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.64 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|