C28H22N4O5S2 — CID 22189437
N-[(Z)-3-[4-[2-(4-nitroanilino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide (PubChem CID 22189437) has the molecular formula C28H22N4O5S2 and a molecular weight of 558.64 g/mol. Its IUPAC name is N-[(Z)-3-[4-[2-(4-nitroanilino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[2-(4-nitroanilino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22189437 |
| Molecular Formula | C28H22N4O5S2 |
| Molecular Weight | 558.64 g/mol |
| Exact Mass | 558.10 |
| IUPAC Name | N-[(Z)-3-[4-[2-(4-nitroanilino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
| SMILES | O=C(CSc1ccc(NC(=O)/C(=C/c2cccs2)NC(=O)c2ccccc2)cc1)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C28H22N4O5S2/c33-26(29-20-8-12-22(13-9-20)32(36)37)18-39-23-14-10-21(11-15-23)30-28(35)25(17-24-7-4-16-38-24)31-27(34)19-5-2-1-3-6-19/h1-17H,18H2,(H,29,33)(H,30,35)(H,31,34)/b25-17- |
| InChIKey | BZWBDDVDWMRCQR-UQQQWYQISA-N |
| XLogP | 5.80 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.64 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|