C30H25N3O5S2 — CID 22189480
3-[[2-[4-[[(Z)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-4-methylbenzoic acid (PubChem CID 22189480) has the molecular formula C30H25N3O5S2 and a molecular weight of 571.68 g/mol. Its IUPAC name is 3-[[2-[4-[[(Z)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-4-methylbenzoic acid.
| Compound Name | 3-[[2-[4-[[(Z)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 22189480 |
| Molecular Formula | C30H25N3O5S2 |
| Molecular Weight | 571.68 g/mol |
| Exact Mass | 571.12 |
| IUPAC Name | 3-[[2-[4-[[(Z)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-4-methylbenzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1NC(=O)CSc1ccc(NC(=O)/C(=C/c2cccs2)NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H25N3O5S2/c1-19-9-10-21(30(37)38)16-25(19)32-27(34)18-40-23-13-11-22(12-14-23)31-29(36)26(17-24-8-5-15-39-24)33-28(35)20-6-3-2-4-7-20/h2-17H,18H2,1H3,(H,31,36)(H,32,34)(H,33,35)(H,37,38)/b26-17- |
| InChIKey | JBYNYMYQTLMTFI-ONUIUJJFSA-N |
| XLogP | 5.90 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.68 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|