C34H31N3O6S — CID 22187380
3-[[2-[4-[[(Z)-2-benzamido-3-(4-ethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-4-methylbenzoic acid (PubChem CID 22187380) has the molecular formula C34H31N3O6S and a molecular weight of 609.70 g/mol. Its IUPAC name is 3-[[2-[4-[[(Z)-2-benzamido-3-(4-ethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-4-methylbenzoic acid.
| Compound Name | 3-[[2-[4-[[(Z)-2-benzamido-3-(4-ethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 22187380 |
| Molecular Formula | C34H31N3O6S |
| Molecular Weight | 609.70 g/mol |
| Exact Mass | 609.19 |
| IUPAC Name | 3-[[2-[4-[[(Z)-2-benzamido-3-(4-ethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-4-methylbenzoic acid |
| SMILES | CCOc1ccc(/C=C(\NC(=O)c2ccccc2)C(=O)Nc2ccc(SCC(=O)Nc3cc(C(=O)O)ccc3C)cc2)cc1 |
| InChI | InChI=1S/C34H31N3O6S/c1-3-43-27-15-10-23(11-16-27)19-30(37-32(39)24-7-5-4-6-8-24)33(40)35-26-13-17-28(18-14-26)44-21-31(38)36-29-20-25(34(41)42)12-9-22(29)2/h4-20H,3,21H2,1-2H3,(H,35,40)(H,36,38)(H,37,39)(H,41,42)/b30-19- |
| InChIKey | LVHSZYOJMNMTRV-FSGOGVSDSA-N |
| XLogP | 6.23 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.70 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|