C29H24N4O5S2 — CID 19312915
N-[(Z)-3-[3-[2-(2-methyl-4-nitroanilino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide (PubChem CID 19312915) has the molecular formula C29H24N4O5S2 and a molecular weight of 572.67 g/mol. Its IUPAC name is N-[(Z)-3-[3-[2-(2-methyl-4-nitroanilino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[3-[2-(2-methyl-4-nitroanilino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19312915 |
| Molecular Formula | C29H24N4O5S2 |
| Molecular Weight | 572.67 g/mol |
| Exact Mass | 572.12 |
| IUPAC Name | N-[(Z)-3-[3-[2-(2-methyl-4-nitroanilino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
| SMILES | Cc1cc([N+](=O)[O-])ccc1NC(=O)CSc1cccc(NC(=O)/C(=C/c2cccs2)NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C29H24N4O5S2/c1-19-15-22(33(37)38)12-13-25(19)31-27(34)18-40-23-10-5-9-21(16-23)30-29(36)26(17-24-11-6-14-39-24)32-28(35)20-7-3-2-4-8-20/h2-17H,18H2,1H3,(H,30,36)(H,31,34)(H,32,35)/b26-17- |
| InChIKey | QLCKQXXMHAZLEY-ONUIUJJFSA-N |
| XLogP | 6.11 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.67 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|