C28H21ClN2O4S — CID 22783498
N-[(Z)-3-[4-[2-(4-chlorophenyl)-2-oxoethyl]sulfanylanilino]-1-(furan-2-yl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 22783498) has the molecular formula C28H21ClN2O4S and a molecular weight of 517.01 g/mol. Its IUPAC name is N-[(Z)-3-[4-[2-(4-chlorophenyl)-2-oxoethyl]sulfanylanilino]-1-(furan-2-yl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[2-(4-chlorophenyl)-2-oxoethyl]sulfanylanilino]-1-(furan-2-yl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22783498 |
| Molecular Formula | C28H21ClN2O4S |
| Molecular Weight | 517.01 g/mol |
| Exact Mass | 516.09 |
| IUPAC Name | N-[(Z)-3-[4-[2-(4-chlorophenyl)-2-oxoethyl]sulfanylanilino]-1-(furan-2-yl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1ccc(SCC(=O)c2ccc(Cl)cc2)cc1)/C(=C/c1ccco1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C28H21ClN2O4S/c29-21-10-8-19(9-11-21)26(32)18-36-24-14-12-22(13-15-24)30-28(34)25(17-23-7-4-16-35-23)31-27(33)20-5-2-1-3-6-20/h1-17H,18H2,(H,30,34)(H,31,33)/b25-17- |
| InChIKey | QKULXNNPVRBGBW-UQQQWYQISA-N |
| XLogP | 6.32 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.01 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|