C34H26N2O4S — CID 74017485
N-[3-oxo-3-(4-phenacylsulfanylanilino)-1-(5-phenylfuran-2-yl)prop-1-en-2-yl]benzamide (PubChem CID 74017485) has the molecular formula C34H26N2O4S and a molecular weight of 558.66 g/mol. Its IUPAC name is N-[3-oxo-3-(4-phenacylsulfanylanilino)-1-(5-phenylfuran-2-yl)prop-1-en-2-yl]benzamide.
| Compound Name | N-[3-oxo-3-(4-phenacylsulfanylanilino)-1-(5-phenylfuran-2-yl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 74017485 |
| Molecular Formula | C34H26N2O4S |
| Molecular Weight | 558.66 g/mol |
| Exact Mass | 558.16 |
| IUPAC Name | N-[3-oxo-3-(4-phenacylsulfanylanilino)-1-(5-phenylfuran-2-yl)prop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1ccc(SCC(=O)c2ccccc2)cc1)C(=Cc1ccc(-c2ccccc2)o1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C34H26N2O4S/c37-31(24-10-4-1-5-11-24)23-41-29-19-16-27(17-20-29)35-34(39)30(36-33(38)26-14-8-3-9-15-26)22-28-18-21-32(40-28)25-12-6-2-7-13-25/h1-22H,23H2,(H,35,39)(H,36,38) |
| InChIKey | JUAFDCYJTMSQJR-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.66 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|