C35H27N3O6S — CID 23101699
N-[(E)-3-[4-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-(5-phenylfuran-2-yl)prop-1-en-2-yl]benzamide (PubChem CID 23101699) has the molecular formula C35H27N3O6S and a molecular weight of 617.68 g/mol. Its IUPAC name is N-[(E)-3-[4-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-(5-phenylfuran-2-yl)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[4-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-(5-phenylfuran-2-yl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 23101699 |
| Molecular Formula | C35H27N3O6S |
| Molecular Weight | 617.68 g/mol |
| Exact Mass | 617.16 |
| IUPAC Name | N-[(E)-3-[4-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-(5-phenylfuran-2-yl)prop-1-en-2-yl]benzamide |
| SMILES | O=C(CSc1ccc(NC(=O)/C(=C\c2ccc(-c3ccccc3)o2)NC(=O)c2ccccc2)cc1)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C35H27N3O6S/c39-33(36-26-13-17-31-32(19-26)43-22-42-31)21-45-28-15-11-25(12-16-28)37-35(41)29(38-34(40)24-9-5-2-6-10-24)20-27-14-18-30(44-27)23-7-3-1-4-8-23/h1-20H,21-22H2,(H,36,39)(H,37,41)(H,38,40)/b29-20+ |
| InChIKey | FDLBBLLTFPTLQF-ZTKZIYFRSA-N |
| XLogP | 6.82 |
| TPSA | 118.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.68 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|