C35H30N4O6S2 — CID 19058887
N-[(Z)-1-[5-(4-methylphenyl)furan-2-yl]-3-oxo-3-[4-[2-oxo-2-(4-sulfamoylanilino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 19058887) has the molecular formula C35H30N4O6S2 and a molecular weight of 666.78 g/mol. Its IUPAC name is N-[(Z)-1-[5-(4-methylphenyl)furan-2-yl]-3-oxo-3-[4-[2-oxo-2-(4-sulfamoylanilino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-[5-(4-methylphenyl)furan-2-yl]-3-oxo-3-[4-[2-oxo-2-(4-sulfamoylanilino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19058887 |
| Molecular Formula | C35H30N4O6S2 |
| Molecular Weight | 666.78 g/mol |
| Exact Mass | 666.16 |
| IUPAC Name | N-[(Z)-1-[5-(4-methylphenyl)furan-2-yl]-3-oxo-3-[4-[2-oxo-2-(4-sulfamoylanilino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | Cc1ccc(-c2ccc(/C=C(\NC(=O)c3ccccc3)C(=O)Nc3ccc(SCC(=O)Nc4ccc(S(N)(=O)=O)cc4)cc3)o2)cc1 |
| InChI | InChI=1S/C35H30N4O6S2/c1-23-7-9-24(10-8-23)32-20-15-28(45-32)21-31(39-34(41)25-5-3-2-4-6-25)35(42)38-27-11-16-29(17-12-27)46-22-33(40)37-26-13-18-30(19-14-26)47(36,43)44/h2-21H,22H2,1H3,(H,37,40)(H,38,42)(H,39,41)(H2,36,43,44)/b31-21- |
| InChIKey | ZOWZERYTFHLXKA-YQYKVWLJSA-N |
| XLogP | 6.04 |
| TPSA | 160.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.78 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|