C32H30N4O7S2 — CID 21385937
N-[(Z)-1-(2,5-dimethoxyphenyl)-3-oxo-3-[4-[2-oxo-2-(4-sulfamoylanilino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 21385937) has the molecular formula C32H30N4O7S2 and a molecular weight of 646.75 g/mol. Its IUPAC name is N-[(Z)-1-(2,5-dimethoxyphenyl)-3-oxo-3-[4-[2-oxo-2-(4-sulfamoylanilino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(2,5-dimethoxyphenyl)-3-oxo-3-[4-[2-oxo-2-(4-sulfamoylanilino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 21385937 |
| Molecular Formula | C32H30N4O7S2 |
| Molecular Weight | 646.75 g/mol |
| Exact Mass | 646.16 |
| IUPAC Name | N-[(Z)-1-(2,5-dimethoxyphenyl)-3-oxo-3-[4-[2-oxo-2-(4-sulfamoylanilino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | COc1ccc(OC)c(/C=C(\NC(=O)c2ccccc2)C(=O)Nc2ccc(SCC(=O)Nc3ccc(S(N)(=O)=O)cc3)cc2)c1 |
| InChI | InChI=1S/C32H30N4O7S2/c1-42-25-12-17-29(43-2)22(18-25)19-28(36-31(38)21-6-4-3-5-7-21)32(39)35-24-8-13-26(14-9-24)44-20-30(37)34-23-10-15-27(16-11-23)45(33,40)41/h3-19H,20H2,1-2H3,(H,34,37)(H,35,39)(H,36,38)(H2,33,40,41)/b28-19- |
| InChIKey | UKPFPROQPCFSAQ-USHMODERSA-N |
| XLogP | 4.49 |
| TPSA | 165.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.75 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|