C33H30N4O6S — CID 21385941
2-[[2-[4-[[(Z)-2-benzamido-3-(2,5-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzamide (PubChem CID 21385941) has the molecular formula C33H30N4O6S and a molecular weight of 610.69 g/mol. Its IUPAC name is 2-[[2-[4-[[(Z)-2-benzamido-3-(2,5-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzamide.
| Compound Name | 2-[[2-[4-[[(Z)-2-benzamido-3-(2,5-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzamide |
|---|---|
| PubChem CID | 21385941 |
| Molecular Formula | C33H30N4O6S |
| Molecular Weight | 610.69 g/mol |
| Exact Mass | 610.19 |
| IUPAC Name | 2-[[2-[4-[[(Z)-2-benzamido-3-(2,5-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzamide |
| SMILES | COc1ccc(OC)c(/C=C(\NC(=O)c2ccccc2)C(=O)Nc2ccc(SCC(=O)Nc3ccccc3C(N)=O)cc2)c1 |
| InChI | InChI=1S/C33H30N4O6S/c1-42-24-14-17-29(43-2)22(18-24)19-28(37-32(40)21-8-4-3-5-9-21)33(41)35-23-12-15-25(16-13-23)44-20-30(38)36-27-11-7-6-10-26(27)31(34)39/h3-19H,20H2,1-2H3,(H2,34,39)(H,35,41)(H,36,38)(H,37,40)/b28-19- |
| InChIKey | DJIORWATYWQVRO-USHMODERSA-N |
| XLogP | 4.94 |
| TPSA | 148.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.69 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|