C35H28N4O5S — CID 74017504
4-[[2-[4-[[2-benzamido-3-(5-phenylfuran-2-yl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzamide (PubChem CID 74017504) has the molecular formula C35H28N4O5S and a molecular weight of 616.70 g/mol. Its IUPAC name is 4-[[2-[4-[[2-benzamido-3-(5-phenylfuran-2-yl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzamide.
| Compound Name | 4-[[2-[4-[[2-benzamido-3-(5-phenylfuran-2-yl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzamide |
|---|---|
| PubChem CID | 74017504 |
| Molecular Formula | C35H28N4O5S |
| Molecular Weight | 616.70 g/mol |
| Exact Mass | 616.18 |
| IUPAC Name | 4-[[2-[4-[[2-benzamido-3-(5-phenylfuran-2-yl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzamide |
| SMILES | NC(=O)c1ccc(NC(=O)CSc2ccc(NC(=O)C(=Cc3ccc(-c4ccccc4)o3)NC(=O)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C35H28N4O5S/c36-33(41)24-11-13-26(14-12-24)37-32(40)22-45-29-18-15-27(16-19-29)38-35(43)30(39-34(42)25-9-5-2-6-10-25)21-28-17-20-31(44-28)23-7-3-1-4-8-23/h1-21H,22H2,(H2,36,41)(H,37,40)(H,38,43)(H,39,42) |
| InChIKey | MEPYPWBRXJCCNB-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 143.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.70 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|