C37H31N3O7S — CID 74017579
methyl 4-[[2-[4-[[2-benzamido-3-[5-(2-methoxyphenyl)furan-2-yl]prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzoate (PubChem CID 74017579) has the molecular formula C37H31N3O7S and a molecular weight of 661.74 g/mol. Its IUPAC name is methyl 4-[[2-[4-[[2-benzamido-3-[5-(2-methoxyphenyl)furan-2-yl]prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-[4-[[2-benzamido-3-[5-(2-methoxyphenyl)furan-2-yl]prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzoate |
|---|---|
| PubChem CID | 74017579 |
| Molecular Formula | C37H31N3O7S |
| Molecular Weight | 661.74 g/mol |
| Exact Mass | 661.19 |
| IUPAC Name | methyl 4-[[2-[4-[[2-benzamido-3-[5-(2-methoxyphenyl)furan-2-yl]prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)CSc2ccc(NC(=O)C(=Cc3ccc(-c4ccccc4OC)o3)NC(=O)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C37H31N3O7S/c1-45-32-11-7-6-10-30(32)33-21-18-28(47-33)22-31(40-35(42)24-8-4-3-5-9-24)36(43)39-27-16-19-29(20-17-27)48-23-34(41)38-26-14-12-25(13-15-26)37(44)46-2/h3-22H,23H2,1-2H3,(H,38,41)(H,39,43)(H,40,42) |
| InChIKey | BJVZBZWDYCTGIQ-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 135.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.74 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|