C35H28ClN3O5S — CID 23101788
N-[(E)-3-[4-[2-(2-chloroanilino)-2-oxoethyl]sulfanylanilino]-1-[5-(2-methoxyphenyl)furan-2-yl]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 23101788) has the molecular formula C35H28ClN3O5S and a molecular weight of 638.15 g/mol. Its IUPAC name is N-[(E)-3-[4-[2-(2-chloroanilino)-2-oxoethyl]sulfanylanilino]-1-[5-(2-methoxyphenyl)furan-2-yl]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[4-[2-(2-chloroanilino)-2-oxoethyl]sulfanylanilino]-1-[5-(2-methoxyphenyl)furan-2-yl]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 23101788 |
| Molecular Formula | C35H28ClN3O5S |
| Molecular Weight | 638.15 g/mol |
| Exact Mass | 637.14 |
| IUPAC Name | N-[(E)-3-[4-[2-(2-chloroanilino)-2-oxoethyl]sulfanylanilino]-1-[5-(2-methoxyphenyl)furan-2-yl]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1ccccc1-c1ccc(/C=C(/NC(=O)c2ccccc2)C(=O)Nc2ccc(SCC(=O)Nc3ccccc3Cl)cc2)o1 |
| InChI | InChI=1S/C35H28ClN3O5S/c1-43-31-14-8-5-11-27(31)32-20-17-25(44-32)21-30(39-34(41)23-9-3-2-4-10-23)35(42)37-24-15-18-26(19-16-24)45-22-33(40)38-29-13-7-6-12-28(29)36/h2-21H,22H2,1H3,(H,37,42)(H,38,40)(H,39,41)/b30-21+ |
| InChIKey | KRQZNWISODUZPS-MWAVMZGNSA-N |
| XLogP | 7.75 |
| TPSA | 109.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.15 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|