C42H34N4O5S — CID 74017507
N-[3-[4-[2-(4-acetamidoanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(5-phenylfuran-2-yl)prop-1-en-2-yl]benzamide (PubChem CID 74017507) has the molecular formula C42H34N4O5S and a molecular weight of 706.82 g/mol. Its IUPAC name is N-[3-[4-[2-(4-acetamidoanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(5-phenylfuran-2-yl)prop-1-en-2-yl]benzamide.
| Compound Name | N-[3-[4-[2-(4-acetamidoanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(5-phenylfuran-2-yl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 74017507 |
| Molecular Formula | C42H34N4O5S |
| Molecular Weight | 706.82 g/mol |
| Exact Mass | 706.22 |
| IUPAC Name | N-[3-[4-[2-(4-acetamidoanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(5-phenylfuran-2-yl)prop-1-en-2-yl]benzamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)C(Sc2ccc(NC(=O)C(=Cc3ccc(-c4ccccc4)o3)NC(=O)c3ccccc3)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C42H34N4O5S/c1-28(47)43-32-17-19-33(20-18-32)45-42(50)39(30-13-7-3-8-14-30)52-36-24-21-34(22-25-36)44-41(49)37(46-40(48)31-15-9-4-10-16-31)27-35-23-26-38(51-35)29-11-5-2-6-12-29/h2-27,39H,1H3,(H,43,47)(H,44,49)(H,45,50)(H,46,48) |
| InChIKey | FEVDLLFBSXCFJZ-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 129.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.82 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|