C45H41N3O5S — CID 19058954
N-[(Z)-3-[4-[2-(4-butoxyanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-[5-(4-methylphenyl)furan-2-yl]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19058954) has the molecular formula C45H41N3O5S and a molecular weight of 735.91 g/mol. Its IUPAC name is N-[(Z)-3-[4-[2-(4-butoxyanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-[5-(4-methylphenyl)furan-2-yl]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[2-(4-butoxyanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-[5-(4-methylphenyl)furan-2-yl]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19058954 |
| Molecular Formula | C45H41N3O5S |
| Molecular Weight | 735.91 g/mol |
| Exact Mass | 735.28 |
| IUPAC Name | N-[(Z)-3-[4-[2-(4-butoxyanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-[5-(4-methylphenyl)furan-2-yl]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCCCOc1ccc(NC(=O)C(Sc2ccc(NC(=O)/C(=C/c3ccc(-c4ccc(C)cc4)o3)NC(=O)c3ccccc3)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C45H41N3O5S/c1-3-4-29-52-37-23-19-35(20-24-37)47-45(51)42(33-11-7-5-8-12-33)54-39-26-21-36(22-27-39)46-44(50)40(48-43(49)34-13-9-6-10-14-34)30-38-25-28-41(53-38)32-17-15-31(2)16-18-32/h5-28,30,42H,3-4,29H2,1-2H3,(H,46,50)(H,47,51)(H,48,49)/b40-30- |
| InChIKey | BTOYEIPBLOOKJJ-DFGGBBJBSA-N |
| XLogP | 10.32 |
| TPSA | 109.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.91 |
| LogP ≤ 5 | 10.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|