C39H31N3O4S — CID 23101661
N-[(E)-3-[4-[1-(naphthalen-1-ylamino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxo-1-(5-phenylfuran-2-yl)prop-1-en-2-yl]benzamide (PubChem CID 23101661) has the molecular formula C39H31N3O4S and a molecular weight of 637.76 g/mol. Its IUPAC name is N-[(E)-3-[4-[1-(naphthalen-1-ylamino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxo-1-(5-phenylfuran-2-yl)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[4-[1-(naphthalen-1-ylamino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxo-1-(5-phenylfuran-2-yl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 23101661 |
| Molecular Formula | C39H31N3O4S |
| Molecular Weight | 637.76 g/mol |
| Exact Mass | 637.20 |
| IUPAC Name | N-[(E)-3-[4-[1-(naphthalen-1-ylamino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxo-1-(5-phenylfuran-2-yl)prop-1-en-2-yl]benzamide |
| SMILES | CC(Sc1ccc(NC(=O)/C(=C\c2ccc(-c3ccccc3)o2)NC(=O)c2ccccc2)cc1)C(=O)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C39H31N3O4S/c1-26(37(43)41-34-18-10-16-27-11-8-9-17-33(27)34)47-32-22-19-30(20-23-32)40-39(45)35(42-38(44)29-14-6-3-7-15-29)25-31-21-24-36(46-31)28-12-4-2-5-13-28/h2-26H,1H3,(H,40,45)(H,41,43)(H,42,44)/b35-25+ |
| InChIKey | FTAJLJHCYKUZDD-KVQDIILNSA-N |
| XLogP | 8.63 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.76 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|