C35H27Cl2N3O4S — CID 99665807
N-[(E)-3-[4-[(2S)-1-(2,4-dichloroanilino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxo-1-(5-phenylfuran-2-yl)prop-1-en-2-yl]benzamide (PubChem CID 99665807) has the molecular formula C35H27Cl2N3O4S and a molecular weight of 656.59 g/mol. Its IUPAC name is N-[(E)-3-[4-[(2S)-1-(2,4-dichloroanilino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxo-1-(5-phenylfuran-2-yl)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[4-[(2S)-1-(2,4-dichloroanilino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxo-1-(5-phenylfuran-2-yl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 99665807 |
| Molecular Formula | C35H27Cl2N3O4S |
| Molecular Weight | 656.59 g/mol |
| Exact Mass | 655.11 |
| IUPAC Name | N-[(E)-3-[4-[(2S)-1-(2,4-dichloroanilino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxo-1-(5-phenylfuran-2-yl)prop-1-en-2-yl]benzamide |
| SMILES | C[C@H](Sc1ccc(NC(=O)/C(=C\c2ccc(-c3ccccc3)o2)NC(=O)c2ccccc2)cc1)C(=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C35H27Cl2N3O4S/c1-22(33(41)39-30-18-12-25(36)20-29(30)37)45-28-16-13-26(14-17-28)38-35(43)31(40-34(42)24-10-6-3-7-11-24)21-27-15-19-32(44-27)23-8-4-2-5-9-23/h2-22H,1H3,(H,38,43)(H,39,41)(H,40,42)/b31-21+/t22-/m0/s1 |
| InChIKey | VUIYTQIPVALSPX-BMPDOFJVSA-N |
| XLogP | 8.78 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.59 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|