C39H33Cl2N3O3S — CID 22188238
N-[(Z)-3-[4-[2-(2,4-dichloroanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(4-propan-2-ylphenyl)prop-1-en-2-yl]benzamide (PubChem CID 22188238) has the molecular formula C39H33Cl2N3O3S and a molecular weight of 694.68 g/mol. Its IUPAC name is N-[(Z)-3-[4-[2-(2,4-dichloroanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(4-propan-2-ylphenyl)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[2-(2,4-dichloroanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(4-propan-2-ylphenyl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22188238 |
| Molecular Formula | C39H33Cl2N3O3S |
| Molecular Weight | 694.68 g/mol |
| Exact Mass | 693.16 |
| IUPAC Name | N-[(Z)-3-[4-[2-(2,4-dichloroanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(4-propan-2-ylphenyl)prop-1-en-2-yl]benzamide |
| SMILES | CC(C)c1ccc(/C=C(\NC(=O)c2ccccc2)C(=O)Nc2ccc(SC(C(=O)Nc3ccc(Cl)cc3Cl)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C39H33Cl2N3O3S/c1-25(2)27-15-13-26(14-16-27)23-35(44-37(45)29-11-7-4-8-12-29)38(46)42-31-18-20-32(21-19-31)48-36(28-9-5-3-6-10-28)39(47)43-34-22-17-30(40)24-33(34)41/h3-25,36H,1-2H3,(H,42,46)(H,43,47)(H,44,45)/b35-23- |
| InChIKey | FLRZLDHQOXRFMS-NHYZDEDTSA-N |
| XLogP | 10.00 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.68 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|