C30H22ClN3O5S — CID 22783258
N-[(Z)-3-[4-[2-(4-chlorophenyl)-2-oxoethyl]sulfanylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 22783258) has the molecular formula C30H22ClN3O5S and a molecular weight of 572.04 g/mol. Its IUPAC name is N-[(Z)-3-[4-[2-(4-chlorophenyl)-2-oxoethyl]sulfanylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[2-(4-chlorophenyl)-2-oxoethyl]sulfanylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22783258 |
| Molecular Formula | C30H22ClN3O5S |
| Molecular Weight | 572.04 g/mol |
| Exact Mass | 571.10 |
| IUPAC Name | N-[(Z)-3-[4-[2-(4-chlorophenyl)-2-oxoethyl]sulfanylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1ccc(SCC(=O)c2ccc(Cl)cc2)cc1)/C(=C/c1ccccc1[N+](=O)[O-])NC(=O)c1ccccc1 |
| InChI | InChI=1S/C30H22ClN3O5S/c31-23-12-10-20(11-13-23)28(35)19-40-25-16-14-24(15-17-25)32-30(37)26(33-29(36)21-6-2-1-3-7-21)18-22-8-4-5-9-27(22)34(38)39/h1-18H,19H2,(H,32,37)(H,33,36)/b26-18- |
| InChIKey | VURGLUSHFFXKMI-ITYLOYPMSA-N |
| XLogP | 6.63 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.04 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|