C30H22BrClN2O3S — CID 22783221
N-[(Z)-3-[4-[2-(4-bromophenyl)-2-oxoethyl]sulfanylanilino]-1-(2-chlorophenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 22783221) has the molecular formula C30H22BrClN2O3S and a molecular weight of 605.94 g/mol. Its IUPAC name is N-[(Z)-3-[4-[2-(4-bromophenyl)-2-oxoethyl]sulfanylanilino]-1-(2-chlorophenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[2-(4-bromophenyl)-2-oxoethyl]sulfanylanilino]-1-(2-chlorophenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22783221 |
| Molecular Formula | C30H22BrClN2O3S |
| Molecular Weight | 605.94 g/mol |
| Exact Mass | 604.02 |
| IUPAC Name | N-[(Z)-3-[4-[2-(4-bromophenyl)-2-oxoethyl]sulfanylanilino]-1-(2-chlorophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1ccc(SCC(=O)c2ccc(Br)cc2)cc1)/C(=C/c1ccccc1Cl)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C30H22BrClN2O3S/c31-23-12-10-20(11-13-23)28(35)19-38-25-16-14-24(15-17-25)33-30(37)27(18-22-8-4-5-9-26(22)32)34-29(36)21-6-2-1-3-7-21/h1-18H,19H2,(H,33,37)(H,34,36)/b27-18- |
| InChIKey | IXAXVGDHZSLJDW-IMRQLAEWSA-N |
| XLogP | 7.49 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.94 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|