C36H26ClN3O3S2 — CID 22193246
N-[(Z)-1-(2-chlorophenyl)-3-oxo-3-[4-(2-oxo-2-phenothiazin-10-ylethyl)sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 22193246) has the molecular formula C36H26ClN3O3S2 and a molecular weight of 648.21 g/mol. Its IUPAC name is N-[(Z)-1-(2-chlorophenyl)-3-oxo-3-[4-(2-oxo-2-phenothiazin-10-ylethyl)sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(2-chlorophenyl)-3-oxo-3-[4-(2-oxo-2-phenothiazin-10-ylethyl)sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22193246 |
| Molecular Formula | C36H26ClN3O3S2 |
| Molecular Weight | 648.21 g/mol |
| Exact Mass | 647.11 |
| IUPAC Name | N-[(Z)-1-(2-chlorophenyl)-3-oxo-3-[4-(2-oxo-2-phenothiazin-10-ylethyl)sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1ccc(SCC(=O)N2c3ccccc3Sc3ccccc32)cc1)/C(=C/c1ccccc1Cl)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C36H26ClN3O3S2/c37-28-13-5-4-12-25(28)22-29(39-35(42)24-10-2-1-3-11-24)36(43)38-26-18-20-27(21-19-26)44-23-34(41)40-30-14-6-8-16-32(30)45-33-17-9-7-15-31(33)40/h1-22H,23H2,(H,38,43)(H,39,42)/b29-22- |
| InChIKey | UCFUMEQKMHVTIK-IADYIPOJSA-N |
| XLogP | 8.67 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.21 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|