C38H28N4O3S2 — CID 19059419
N-[(Z)-1-(1H-indol-3-yl)-3-oxo-3-[4-(2-oxo-2-phenothiazin-10-ylethyl)sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 19059419) has the molecular formula C38H28N4O3S2 and a molecular weight of 652.80 g/mol. Its IUPAC name is N-[(Z)-1-(1H-indol-3-yl)-3-oxo-3-[4-(2-oxo-2-phenothiazin-10-ylethyl)sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(1H-indol-3-yl)-3-oxo-3-[4-(2-oxo-2-phenothiazin-10-ylethyl)sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19059419 |
| Molecular Formula | C38H28N4O3S2 |
| Molecular Weight | 652.80 g/mol |
| Exact Mass | 652.16 |
| IUPAC Name | N-[(Z)-1-(1H-indol-3-yl)-3-oxo-3-[4-(2-oxo-2-phenothiazin-10-ylethyl)sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1ccc(SCC(=O)N2c3ccccc3Sc3ccccc32)cc1)/C(=C/c1c[nH]c2ccccc12)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C38H28N4O3S2/c43-36(42-32-14-6-8-16-34(32)47-35-17-9-7-15-33(35)42)24-46-28-20-18-27(19-21-28)40-38(45)31(41-37(44)25-10-2-1-3-11-25)22-26-23-39-30-13-5-4-12-29(26)30/h1-23,39H,24H2,(H,40,45)(H,41,44)/b31-22- |
| InChIKey | PRTSBMJOBRYWDQ-VAMRJTSQSA-N |
| XLogP | 8.50 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.80 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|