C32H24Cl2N4O3S — CID 124658020
N-[(E)-3-[4-[2-(2,4-dichloroanilino)-2-oxoethyl]sulfanylanilino]-1-(1H-indol-3-yl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 124658020) has the molecular formula C32H24Cl2N4O3S and a molecular weight of 615.54 g/mol. Its IUPAC name is N-[(E)-3-[4-[2-(2,4-dichloroanilino)-2-oxoethyl]sulfanylanilino]-1-(1H-indol-3-yl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[4-[2-(2,4-dichloroanilino)-2-oxoethyl]sulfanylanilino]-1-(1H-indol-3-yl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 124658020 |
| Molecular Formula | C32H24Cl2N4O3S |
| Molecular Weight | 615.54 g/mol |
| Exact Mass | 614.09 |
| IUPAC Name | N-[(E)-3-[4-[2-(2,4-dichloroanilino)-2-oxoethyl]sulfanylanilino]-1-(1H-indol-3-yl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(CSc1ccc(NC(=O)/C(=C\c2c[nH]c3ccccc23)NC(=O)c2ccccc2)cc1)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C32H24Cl2N4O3S/c33-22-10-15-28(26(34)17-22)37-30(39)19-42-24-13-11-23(12-14-24)36-32(41)29(38-31(40)20-6-2-1-3-7-20)16-21-18-35-27-9-5-4-8-25(21)27/h1-18,35H,19H2,(H,36,41)(H,37,39)(H,38,40)/b29-16+ |
| InChIKey | VTUPXGWQKMCHQY-MUFRIFMGSA-N |
| XLogP | 7.62 |
| TPSA | 103.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.54 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|