C33H28N4O3S — CID 19315772
N-[(Z)-1-(1H-indol-3-yl)-3-[3-[2-(3-methylanilino)-2-oxoethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19315772) has the molecular formula C33H28N4O3S and a molecular weight of 560.68 g/mol. Its IUPAC name is N-[(Z)-1-(1H-indol-3-yl)-3-[3-[2-(3-methylanilino)-2-oxoethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(1H-indol-3-yl)-3-[3-[2-(3-methylanilino)-2-oxoethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19315772 |
| Molecular Formula | C33H28N4O3S |
| Molecular Weight | 560.68 g/mol |
| Exact Mass | 560.19 |
| IUPAC Name | N-[(Z)-1-(1H-indol-3-yl)-3-[3-[2-(3-methylanilino)-2-oxoethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | Cc1cccc(NC(=O)CSc2cccc(NC(=O)/C(=C/c3c[nH]c4ccccc34)NC(=O)c3ccccc3)c2)c1 |
| InChI | InChI=1S/C33H28N4O3S/c1-22-9-7-12-25(17-22)35-31(38)21-41-27-14-8-13-26(19-27)36-33(40)30(37-32(39)23-10-3-2-4-11-23)18-24-20-34-29-16-6-5-15-28(24)29/h2-20,34H,21H2,1H3,(H,35,38)(H,36,40)(H,37,39)/b30-18- |
| InChIKey | XJOPKHDJYKOGHB-YKQZZPSBSA-N |
| XLogP | 6.62 |
| TPSA | 103.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.68 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|