C32H25N3O3S — CID 19059636
N-[(Z)-1-(1H-indol-3-yl)-3-oxo-3-(4-phenacylsulfanylanilino)prop-1-en-2-yl]benzamide (PubChem CID 19059636) has the molecular formula C32H25N3O3S and a molecular weight of 531.64 g/mol. Its IUPAC name is N-[(Z)-1-(1H-indol-3-yl)-3-oxo-3-(4-phenacylsulfanylanilino)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(1H-indol-3-yl)-3-oxo-3-(4-phenacylsulfanylanilino)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19059636 |
| Molecular Formula | C32H25N3O3S |
| Molecular Weight | 531.64 g/mol |
| Exact Mass | 531.16 |
| IUPAC Name | N-[(Z)-1-(1H-indol-3-yl)-3-oxo-3-(4-phenacylsulfanylanilino)prop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1ccc(SCC(=O)c2ccccc2)cc1)/C(=C/c1c[nH]c2ccccc12)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C32H25N3O3S/c36-30(22-9-3-1-4-10-22)21-39-26-17-15-25(16-18-26)34-32(38)29(35-31(37)23-11-5-2-6-12-23)19-24-20-33-28-14-8-7-13-27(24)28/h1-20,33H,21H2,(H,34,38)(H,35,37)/b29-19- |
| InChIKey | JCTBYSBHBZTKEQ-CEUNXORHSA-N |
| XLogP | 6.55 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.64 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|