C36H27ClN2O3S — CID 19301118
N-[(Z)-1-(2-chlorophenyl)-3-oxo-3-[3-[2-oxo-2-(4-phenylphenyl)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 19301118) has the molecular formula C36H27ClN2O3S and a molecular weight of 603.14 g/mol. Its IUPAC name is N-[(Z)-1-(2-chlorophenyl)-3-oxo-3-[3-[2-oxo-2-(4-phenylphenyl)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(2-chlorophenyl)-3-oxo-3-[3-[2-oxo-2-(4-phenylphenyl)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19301118 |
| Molecular Formula | C36H27ClN2O3S |
| Molecular Weight | 603.14 g/mol |
| Exact Mass | 602.14 |
| IUPAC Name | N-[(Z)-1-(2-chlorophenyl)-3-oxo-3-[3-[2-oxo-2-(4-phenylphenyl)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1cccc(SCC(=O)c2ccc(-c3ccccc3)cc2)c1)/C(=C/c1ccccc1Cl)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C36H27ClN2O3S/c37-32-17-8-7-14-29(32)22-33(39-35(41)28-12-5-2-6-13-28)36(42)38-30-15-9-16-31(23-30)43-24-34(40)27-20-18-26(19-21-27)25-10-3-1-4-11-25/h1-23H,24H2,(H,38,42)(H,39,41)/b33-22- |
| InChIKey | XUPYIDYWOQPKJO-NVMPUMLXSA-N |
| XLogP | 8.39 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.14 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|