C30H21ClF2N2O3S — CID 19301089
N-[(Z)-1-(2-chloro-6-fluorophenyl)-3-[3-[2-(4-fluorophenyl)-2-oxoethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19301089) has the molecular formula C30H21ClF2N2O3S and a molecular weight of 563.03 g/mol. Its IUPAC name is N-[(Z)-1-(2-chloro-6-fluorophenyl)-3-[3-[2-(4-fluorophenyl)-2-oxoethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(2-chloro-6-fluorophenyl)-3-[3-[2-(4-fluorophenyl)-2-oxoethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19301089 |
| Molecular Formula | C30H21ClF2N2O3S |
| Molecular Weight | 563.03 g/mol |
| Exact Mass | 562.09 |
| IUPAC Name | N-[(Z)-1-(2-chloro-6-fluorophenyl)-3-[3-[2-(4-fluorophenyl)-2-oxoethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1cccc(SCC(=O)c2ccc(F)cc2)c1)/C(=C/c1c(F)cccc1Cl)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C30H21ClF2N2O3S/c31-25-10-5-11-26(33)24(25)17-27(35-29(37)20-6-2-1-3-7-20)30(38)34-22-8-4-9-23(16-22)39-18-28(36)19-12-14-21(32)15-13-19/h1-17H,18H2,(H,34,38)(H,35,37)/b27-17- |
| InChIKey | YLBKANOIAZJOED-PKAZHMFMSA-N |
| XLogP | 7.00 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.03 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|