C25H20ClFN2O4S — CID 19300195
methyl 2-[3-[[(Z)-2-benzamido-3-(2-chloro-6-fluorophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetate (PubChem CID 19300195) has the molecular formula C25H20ClFN2O4S and a molecular weight of 498.96 g/mol. Its IUPAC name is methyl 2-[3-[[(Z)-2-benzamido-3-(2-chloro-6-fluorophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetate.
| Compound Name | methyl 2-[3-[[(Z)-2-benzamido-3-(2-chloro-6-fluorophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetate |
|---|---|
| PubChem CID | 19300195 |
| Molecular Formula | C25H20ClFN2O4S |
| Molecular Weight | 498.96 g/mol |
| Exact Mass | 498.08 |
| IUPAC Name | methyl 2-[3-[[(Z)-2-benzamido-3-(2-chloro-6-fluorophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetate |
| SMILES | COC(=O)CSc1cccc(NC(=O)/C(=C/c2c(F)cccc2Cl)NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C25H20ClFN2O4S/c1-33-23(30)15-34-18-10-5-9-17(13-18)28-25(32)22(14-19-20(26)11-6-12-21(19)27)29-24(31)16-7-3-2-4-8-16/h2-14H,15H2,1H3,(H,28,32)(H,29,31)/b22-14- |
| InChIKey | NSKYBQVJIJWHHW-HMAPJEAMSA-N |
| XLogP | 5.15 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.96 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|