C26H24N2O4S — CID 19300884
methyl 2-[3-[[(E)-2-benzamido-3-(4-methylphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetate (PubChem CID 19300884) has the molecular formula C26H24N2O4S and a molecular weight of 460.56 g/mol. Its IUPAC name is methyl 2-[3-[[(E)-2-benzamido-3-(4-methylphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetate.
| Compound Name | methyl 2-[3-[[(E)-2-benzamido-3-(4-methylphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetate |
|---|---|
| PubChem CID | 19300884 |
| Molecular Formula | C26H24N2O4S |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | methyl 2-[3-[[(E)-2-benzamido-3-(4-methylphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetate |
| SMILES | COC(=O)CSc1cccc(NC(=O)/C(=C\c2ccc(C)cc2)NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C26H24N2O4S/c1-18-11-13-19(14-12-18)15-23(28-25(30)20-7-4-3-5-8-20)26(31)27-21-9-6-10-22(16-21)33-17-24(29)32-2/h3-16H,17H2,1-2H3,(H,27,31)(H,28,30)/b23-15+ |
| InChIKey | LIVTWOOBGJTTOI-HZHRSRAPSA-N |
| XLogP | 4.67 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|