C31H24Cl2N2O3S — CID 19301625
N-[(Z)-3-[3-[2-(2,4-dichlorophenyl)-2-oxoethyl]sulfanylanilino]-1-(4-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19301625) has the molecular formula C31H24Cl2N2O3S and a molecular weight of 575.52 g/mol. Its IUPAC name is N-[(Z)-3-[3-[2-(2,4-dichlorophenyl)-2-oxoethyl]sulfanylanilino]-1-(4-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[3-[2-(2,4-dichlorophenyl)-2-oxoethyl]sulfanylanilino]-1-(4-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19301625 |
| Molecular Formula | C31H24Cl2N2O3S |
| Molecular Weight | 575.52 g/mol |
| Exact Mass | 574.09 |
| IUPAC Name | N-[(Z)-3-[3-[2-(2,4-dichlorophenyl)-2-oxoethyl]sulfanylanilino]-1-(4-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | Cc1ccc(/C=C(\NC(=O)c2ccccc2)C(=O)Nc2cccc(SCC(=O)c3ccc(Cl)cc3Cl)c2)cc1 |
| InChI | InChI=1S/C31H24Cl2N2O3S/c1-20-10-12-21(13-11-20)16-28(35-30(37)22-6-3-2-4-7-22)31(38)34-24-8-5-9-25(18-24)39-19-29(36)26-15-14-23(32)17-27(26)33/h2-18H,19H2,1H3,(H,34,38)(H,35,37)/b28-16- |
| InChIKey | ZKCPYKTYIKDVLC-NTFVMDSBSA-N |
| XLogP | 7.69 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.52 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|