C32H26Cl2N2O5S — CID 19301265
N-[(Z)-3-[3-[2-(2,4-dichlorophenyl)-2-oxoethyl]sulfanylanilino]-1-(2,5-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19301265) has the molecular formula C32H26Cl2N2O5S and a molecular weight of 621.54 g/mol. Its IUPAC name is N-[(Z)-3-[3-[2-(2,4-dichlorophenyl)-2-oxoethyl]sulfanylanilino]-1-(2,5-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[3-[2-(2,4-dichlorophenyl)-2-oxoethyl]sulfanylanilino]-1-(2,5-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19301265 |
| Molecular Formula | C32H26Cl2N2O5S |
| Molecular Weight | 621.54 g/mol |
| Exact Mass | 620.09 |
| IUPAC Name | N-[(Z)-3-[3-[2-(2,4-dichlorophenyl)-2-oxoethyl]sulfanylanilino]-1-(2,5-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1ccc(OC)c(/C=C(\NC(=O)c2ccccc2)C(=O)Nc2cccc(SCC(=O)c3ccc(Cl)cc3Cl)c2)c1 |
| InChI | InChI=1S/C32H26Cl2N2O5S/c1-40-24-12-14-30(41-2)21(15-24)16-28(36-31(38)20-7-4-3-5-8-20)32(39)35-23-9-6-10-25(18-23)42-19-29(37)26-13-11-22(33)17-27(26)34/h3-18H,19H2,1-2H3,(H,35,39)(H,36,38)/b28-16- |
| InChIKey | ZFXMPWYAOMWJNN-NTFVMDSBSA-N |
| XLogP | 7.40 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.54 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|