C30H21Cl3N2O3S — CID 19301139
N-[(Z)-1-(4-chlorophenyl)-3-[3-[2-(2,4-dichlorophenyl)-2-oxoethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19301139) has the molecular formula C30H21Cl3N2O3S and a molecular weight of 595.94 g/mol. Its IUPAC name is N-[(Z)-1-(4-chlorophenyl)-3-[3-[2-(2,4-dichlorophenyl)-2-oxoethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(4-chlorophenyl)-3-[3-[2-(2,4-dichlorophenyl)-2-oxoethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19301139 |
| Molecular Formula | C30H21Cl3N2O3S |
| Molecular Weight | 595.94 g/mol |
| Exact Mass | 594.03 |
| IUPAC Name | N-[(Z)-1-(4-chlorophenyl)-3-[3-[2-(2,4-dichlorophenyl)-2-oxoethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1cccc(SCC(=O)c2ccc(Cl)cc2Cl)c1)/C(=C/c1ccc(Cl)cc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C30H21Cl3N2O3S/c31-21-11-9-19(10-12-21)15-27(35-29(37)20-5-2-1-3-6-20)30(38)34-23-7-4-8-24(17-23)39-18-28(36)25-14-13-22(32)16-26(25)33/h1-17H,18H2,(H,34,38)(H,35,37)/b27-15- |
| InChIKey | BZLBXVIPTIMEMW-DICXZTSXSA-N |
| XLogP | 8.03 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.94 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|