C28H20Cl2N2O3S2 — CID 19301201
N-[(Z)-1-(2,4-dichlorophenyl)-3-oxo-3-[3-(2-oxo-2-thiophen-2-ylethyl)sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 19301201) has the molecular formula C28H20Cl2N2O3S2 and a molecular weight of 567.52 g/mol. Its IUPAC name is N-[(Z)-1-(2,4-dichlorophenyl)-3-oxo-3-[3-(2-oxo-2-thiophen-2-ylethyl)sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(2,4-dichlorophenyl)-3-oxo-3-[3-(2-oxo-2-thiophen-2-ylethyl)sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19301201 |
| Molecular Formula | C28H20Cl2N2O3S2 |
| Molecular Weight | 567.52 g/mol |
| Exact Mass | 566.03 |
| IUPAC Name | N-[(Z)-1-(2,4-dichlorophenyl)-3-oxo-3-[3-(2-oxo-2-thiophen-2-ylethyl)sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1cccc(SCC(=O)c2cccs2)c1)/C(=C/c1ccc(Cl)cc1Cl)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C28H20Cl2N2O3S2/c29-20-12-11-19(23(30)15-20)14-24(32-27(34)18-6-2-1-3-7-18)28(35)31-21-8-4-9-22(16-21)37-17-25(33)26-10-5-13-36-26/h1-16H,17H2,(H,31,35)(H,32,34)/b24-14- |
| InChIKey | LMIMOTYECGRKHK-OYKKKHCWSA-N |
| XLogP | 7.44 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.52 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|