C37H29N3O3S — CID 19300897
N-[(E)-3-[3-(2-carbazol-9-yl-2-oxoethyl)sulfanylanilino]-1-(4-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19300897) has the molecular formula C37H29N3O3S and a molecular weight of 595.72 g/mol. Its IUPAC name is N-[(E)-3-[3-(2-carbazol-9-yl-2-oxoethyl)sulfanylanilino]-1-(4-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-(2-carbazol-9-yl-2-oxoethyl)sulfanylanilino]-1-(4-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19300897 |
| Molecular Formula | C37H29N3O3S |
| Molecular Weight | 595.72 g/mol |
| Exact Mass | 595.19 |
| IUPAC Name | N-[(E)-3-[3-(2-carbazol-9-yl-2-oxoethyl)sulfanylanilino]-1-(4-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | Cc1ccc(/C=C(/NC(=O)c2ccccc2)C(=O)Nc2cccc(SCC(=O)n3c4ccccc4c4ccccc43)c2)cc1 |
| InChI | InChI=1S/C37H29N3O3S/c1-25-18-20-26(21-19-25)22-32(39-36(42)27-10-3-2-4-11-27)37(43)38-28-12-9-13-29(23-28)44-24-35(41)40-33-16-7-5-14-30(33)31-15-6-8-17-34(31)40/h2-23H,24H2,1H3,(H,38,43)(H,39,42)/b32-22+ |
| InChIKey | YIQJUZWWEUQSKS-WEMUVCOSSA-N |
| XLogP | 7.95 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.72 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|