C25H21N3O2S — CID 19300882
N-[(E)-3-[3-(cyanomethylsulfanyl)anilino]-1-(4-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19300882) has the molecular formula C25H21N3O2S and a molecular weight of 427.53 g/mol. Its IUPAC name is N-[(E)-3-[3-(cyanomethylsulfanyl)anilino]-1-(4-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-(cyanomethylsulfanyl)anilino]-1-(4-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19300882 |
| Molecular Formula | C25H21N3O2S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | N-[(E)-3-[3-(cyanomethylsulfanyl)anilino]-1-(4-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | Cc1ccc(/C=C(/NC(=O)c2ccccc2)C(=O)Nc2cccc(SCC#N)c2)cc1 |
| InChI | InChI=1S/C25H21N3O2S/c1-18-10-12-19(13-11-18)16-23(28-24(29)20-6-3-2-4-7-20)25(30)27-21-8-5-9-22(17-21)31-15-14-26/h2-13,16-17H,15H2,1H3,(H,27,30)(H,28,29)/b23-16+ |
| InChIKey | RODMOHRTRNPROQ-XQNSMLJCSA-N |
| XLogP | 5.02 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|