C35H28N2O2S — CID 19300796
N-[(E)-3-(3-benzylsulfanylanilino)-3-oxo-1-(4-phenylphenyl)prop-1-en-2-yl]benzamide (PubChem CID 19300796) has the molecular formula C35H28N2O2S and a molecular weight of 540.69 g/mol. Its IUPAC name is N-[(E)-3-(3-benzylsulfanylanilino)-3-oxo-1-(4-phenylphenyl)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-(3-benzylsulfanylanilino)-3-oxo-1-(4-phenylphenyl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19300796 |
| Molecular Formula | C35H28N2O2S |
| Molecular Weight | 540.69 g/mol |
| Exact Mass | 540.19 |
| IUPAC Name | N-[(E)-3-(3-benzylsulfanylanilino)-3-oxo-1-(4-phenylphenyl)prop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1cccc(SCc2ccccc2)c1)/C(=C\c1ccc(-c2ccccc2)cc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C35H28N2O2S/c38-34(30-15-8-3-9-16-30)37-33(23-26-19-21-29(22-20-26)28-13-6-2-7-14-28)35(39)36-31-17-10-18-32(24-31)40-25-27-11-4-1-5-12-27/h1-24H,25H2,(H,36,39)(H,37,38)/b33-23+ |
| InChIKey | XXWIGILPTYZKLB-GZZLJNBRSA-N |
| XLogP | 8.06 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.69 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|