C37H30N4O4S — CID 19312644
2-[[2-[3-[[(E)-2-benzamido-3-(4-phenylphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzamide (PubChem CID 19312644) has the molecular formula C37H30N4O4S and a molecular weight of 626.74 g/mol. Its IUPAC name is 2-[[2-[3-[[(E)-2-benzamido-3-(4-phenylphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzamide.
| Compound Name | 2-[[2-[3-[[(E)-2-benzamido-3-(4-phenylphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzamide |
|---|---|
| PubChem CID | 19312644 |
| Molecular Formula | C37H30N4O4S |
| Molecular Weight | 626.74 g/mol |
| Exact Mass | 626.20 |
| IUPAC Name | 2-[[2-[3-[[(E)-2-benzamido-3-(4-phenylphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzamide |
| SMILES | NC(=O)c1ccccc1NC(=O)CSc1cccc(NC(=O)/C(=C\c2ccc(-c3ccccc3)cc2)NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C37H30N4O4S/c38-35(43)31-16-7-8-17-32(31)40-34(42)24-46-30-15-9-14-29(23-30)39-37(45)33(41-36(44)28-12-5-2-6-13-28)22-25-18-20-27(21-19-25)26-10-3-1-4-11-26/h1-23H,24H2,(H2,38,43)(H,39,45)(H,40,42)(H,41,44)/b33-22+ |
| InChIKey | RMDIAMQUAYZPNU-STKMKYKTSA-N |
| XLogP | 6.59 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.74 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|