C31H24Cl2N4O4S — CID 19307172
2-[[2-[3-[[(E)-2-benzamido-3-(2,6-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzamide (PubChem CID 19307172) has the molecular formula C31H24Cl2N4O4S and a molecular weight of 619.53 g/mol. Its IUPAC name is 2-[[2-[3-[[(E)-2-benzamido-3-(2,6-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzamide.
| Compound Name | 2-[[2-[3-[[(E)-2-benzamido-3-(2,6-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzamide |
|---|---|
| PubChem CID | 19307172 |
| Molecular Formula | C31H24Cl2N4O4S |
| Molecular Weight | 619.53 g/mol |
| Exact Mass | 618.09 |
| IUPAC Name | 2-[[2-[3-[[(E)-2-benzamido-3-(2,6-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzamide |
| SMILES | NC(=O)c1ccccc1NC(=O)CSc1cccc(NC(=O)/C(=C\c2c(Cl)cccc2Cl)NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C31H24Cl2N4O4S/c32-24-13-7-14-25(33)23(24)17-27(37-30(40)19-8-2-1-3-9-19)31(41)35-20-10-6-11-21(16-20)42-18-28(38)36-26-15-5-4-12-22(26)29(34)39/h1-17H,18H2,(H2,34,39)(H,35,41)(H,36,38)(H,37,40)/b27-17+ |
| InChIKey | COUWGLWVEYGYLD-WPWMEQJKSA-N |
| XLogP | 6.23 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.53 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|