C36H27Cl2N3O3S — CID 19300365
N-[(E)-1-(2,6-dichlorophenyl)-3-oxo-3-[3-[2-oxo-2-(N-phenylanilino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 19300365) has the molecular formula C36H27Cl2N3O3S and a molecular weight of 652.60 g/mol. Its IUPAC name is N-[(E)-1-(2,6-dichlorophenyl)-3-oxo-3-[3-[2-oxo-2-(N-phenylanilino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-1-(2,6-dichlorophenyl)-3-oxo-3-[3-[2-oxo-2-(N-phenylanilino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19300365 |
| Molecular Formula | C36H27Cl2N3O3S |
| Molecular Weight | 652.60 g/mol |
| Exact Mass | 651.12 |
| IUPAC Name | N-[(E)-1-(2,6-dichlorophenyl)-3-oxo-3-[3-[2-oxo-2-(N-phenylanilino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1cccc(SCC(=O)N(c2ccccc2)c2ccccc2)c1)/C(=C\c1c(Cl)cccc1Cl)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C36H27Cl2N3O3S/c37-31-20-11-21-32(38)30(31)23-33(40-35(43)25-12-4-1-5-13-25)36(44)39-26-14-10-19-29(22-26)45-24-34(42)41(27-15-6-2-7-16-27)28-17-8-3-9-18-28/h1-23H,24H2,(H,39,44)(H,40,43)/b33-23+ |
| InChIKey | TUDCJJCCUDMPQC-GZZLJNBRSA-N |
| XLogP | 8.86 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.60 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|