C36H28FN3O3S — CID 19300618
N-[(E)-1-(2-fluorophenyl)-3-oxo-3-[3-[2-oxo-2-(N-phenylanilino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 19300618) has the molecular formula C36H28FN3O3S and a molecular weight of 601.70 g/mol. Its IUPAC name is N-[(E)-1-(2-fluorophenyl)-3-oxo-3-[3-[2-oxo-2-(N-phenylanilino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-1-(2-fluorophenyl)-3-oxo-3-[3-[2-oxo-2-(N-phenylanilino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19300618 |
| Molecular Formula | C36H28FN3O3S |
| Molecular Weight | 601.70 g/mol |
| Exact Mass | 601.18 |
| IUPAC Name | N-[(E)-1-(2-fluorophenyl)-3-oxo-3-[3-[2-oxo-2-(N-phenylanilino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1cccc(SCC(=O)N(c2ccccc2)c2ccccc2)c1)/C(=C\c1ccccc1F)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C36H28FN3O3S/c37-32-22-11-10-15-27(32)23-33(39-35(42)26-13-4-1-5-14-26)36(43)38-28-16-12-21-31(24-28)44-25-34(41)40(29-17-6-2-7-18-29)30-19-8-3-9-20-30/h1-24H,25H2,(H,38,43)(H,39,42)/b33-23+ |
| InChIKey | CNVBBCUHLOUZDI-GZZLJNBRSA-N |
| XLogP | 7.69 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.70 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|